C28H22N2O4 — CID 175098119
[5-carbamoyl-9-[(2-phenylphenyl)methyl]carbazol-4-yl] ethaneperoxoate (PubChem CID 175098119) has the molecular formula C28H22N2O4 and a molecular weight of 450.49 g/mol. Its IUPAC name is [5-carbamoyl-9-[(2-phenylphenyl)methyl]carbazol-4-yl] ethaneperoxoate.
| Compound Name | [5-carbamoyl-9-[(2-phenylphenyl)methyl]carbazol-4-yl] ethaneperoxoate |
|---|---|
| PubChem CID | 175098119 |
| Molecular Formula | C28H22N2O4 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [5-carbamoyl-9-[(2-phenylphenyl)methyl]carbazol-4-yl] ethaneperoxoate |
| SMILES | CC(=O)OOc1cccc2c1c1c(C(N)=O)cccc1n2Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C28H22N2O4/c1-18(31)33-34-25-16-8-15-24-27(25)26-22(28(29)32)13-7-14-23(26)30(24)17-20-11-5-6-12-21(20)19-9-3-2-4-10-19/h2-16H,17H2,1H3,(H2,29,32) |
| InChIKey | YQXFYRLXYSDKHO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|