C28H24N2O5 — CID 22359335
2-[3-oxamoyl-1-[(2-phenylphenyl)methyl]-2-propylindol-4-yl]-2-oxoacetic acid (PubChem CID 22359335) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is 2-[3-oxamoyl-1-[(2-phenylphenyl)methyl]-2-propylindol-4-yl]-2-oxoacetic acid.
| Compound Name | 2-[3-oxamoyl-1-[(2-phenylphenyl)methyl]-2-propylindol-4-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 22359335 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 2-[3-oxamoyl-1-[(2-phenylphenyl)methyl]-2-propylindol-4-yl]-2-oxoacetic acid |
| SMILES | CCCc1c(C(=O)C(N)=O)c2c(C(=O)C(=O)O)cccc2n1Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C28H24N2O5/c1-2-9-21-24(26(32)27(29)33)23-20(25(31)28(34)35)14-8-15-22(23)30(21)16-18-12-6-7-13-19(18)17-10-4-3-5-11-17/h3-8,10-15H,2,9,16H2,1H3,(H2,29,33)(H,34,35) |
| InChIKey | KMRFGMDVZJIKQZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|