C22H24N2O5 — CID 174596485
2-(1-benzyl-2-ethyl-4-hydroxyindol-3-yl)-2-oxoacetamide;methyl acetate (PubChem CID 174596485) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-(1-benzyl-2-ethyl-4-hydroxyindol-3-yl)-2-oxoacetamide;methyl acetate.
| Compound Name | 2-(1-benzyl-2-ethyl-4-hydroxyindol-3-yl)-2-oxoacetamide;methyl acetate |
|---|---|
| PubChem CID | 174596485 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-(1-benzyl-2-ethyl-4-hydroxyindol-3-yl)-2-oxoacetamide;methyl acetate |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(O)cccc2n1Cc1ccccc1.COC(C)=O |
| InChI | InChI=1S/C19H18N2O3.C3H6O2/c1-2-13-17(18(23)19(20)24)16-14(9-6-10-15(16)22)21(13)11-12-7-4-3-5-8-12;1-3(4)5-2/h3-10,22H,2,11H2,1H3,(H2,20,24);1-2H3 |
| InChIKey | QLJRIQGEVRVTNB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|