C20H18N4O5 — CID 89359022
2-[1-benzyl-2-ethyl-4-(2-nitroso-2-oxoethoxy)pyrrolo[3,2-c]pyridin-3-yl]-2-oxoacetamide (PubChem CID 89359022) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is 2-[1-benzyl-2-ethyl-4-(2-nitroso-2-oxoethoxy)pyrrolo[3,2-c]pyridin-3-yl]-2-oxoacetamide.
| Compound Name | 2-[1-benzyl-2-ethyl-4-(2-nitroso-2-oxoethoxy)pyrrolo[3,2-c]pyridin-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 89359022 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-[1-benzyl-2-ethyl-4-(2-nitroso-2-oxoethoxy)pyrrolo[3,2-c]pyridin-3-yl]-2-oxoacetamide |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)N=O)nccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C20H18N4O5/c1-2-13-16(18(26)19(21)27)17-14(24(13)10-12-6-4-3-5-7-12)8-9-22-20(17)29-11-15(25)23-28/h3-9H,2,10-11H2,1H3,(H2,21,27) |
| InChIKey | XFXWROAPXLFWHN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|