C27H27N3O5 — CID 89358366
2-[1-[(2Z,4Z)-2-ethenyl-3-phenylhexa-2,4-dienyl]-2-ethyl-3-oxamoylpyrrolo[3,2-c]pyridin-4-yl]oxyacetic acid (PubChem CID 89358366) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is 2-[1-[(2Z,4Z)-2-ethenyl-3-phenylhexa-2,4-dienyl]-2-ethyl-3-oxamoylpyrrolo[3,2-c]pyridin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-[(2Z,4Z)-2-ethenyl-3-phenylhexa-2,4-dienyl]-2-ethyl-3-oxamoylpyrrolo[3,2-c]pyridin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 89358366 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 2-[1-[(2Z,4Z)-2-ethenyl-3-phenylhexa-2,4-dienyl]-2-ethyl-3-oxamoylpyrrolo[3,2-c]pyridin-4-yl]oxyacetic acid |
| SMILES | C=C/C(Cn1c(CC)c(C(=O)C(N)=O)c2c(OCC(=O)O)nccc21)=C(\C=C/C)c1ccccc1 |
| InChI | InChI=1S/C27H27N3O5/c1-4-10-19(18-11-8-7-9-12-18)17(5-2)15-30-20(6-3)23(25(33)26(28)34)24-21(30)13-14-29-27(24)35-16-22(31)32/h4-5,7-14H,2,6,15-16H2,1,3H3,(H2,28,34)(H,31,32)/b10-4-,19-17- |
| InChIKey | HEWFJMBZDDAINB-GGKHDDQXSA-N |
| XLogP | 3.95 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|