C27H25N3O5 — CID 22449253
2-(3,6-dibenzyl-7-ethyl-8-oxamoylpyrrolo[1,2-a]pyrazin-1-yl)oxyacetic acid (PubChem CID 22449253) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is 2-(3,6-dibenzyl-7-ethyl-8-oxamoylpyrrolo[1,2-a]pyrazin-1-yl)oxyacetic acid.
| Compound Name | 2-(3,6-dibenzyl-7-ethyl-8-oxamoylpyrrolo[1,2-a]pyrazin-1-yl)oxyacetic acid |
|---|---|
| PubChem CID | 22449253 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-(3,6-dibenzyl-7-ethyl-8-oxamoylpyrrolo[1,2-a]pyrazin-1-yl)oxyacetic acid |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)O)nc(Cc3ccccc3)cn2c1Cc1ccccc1 |
| InChI | InChI=1S/C27H25N3O5/c1-2-20-21(14-18-11-7-4-8-12-18)30-15-19(13-17-9-5-3-6-10-17)29-27(35-16-22(31)32)24(30)23(20)25(33)26(28)34/h3-12,15H,2,13-14,16H2,1H3,(H2,28,34)(H,31,32) |
| InChIKey | FJWABSVKVWLRSY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|