C30H26N2O3 — CID 10576018
2-[2-ethyl-3-(naphthalen-2-ylmethyl)-8-phenylmethoxyindolizin-1-yl]-2-oxoacetamide (PubChem CID 10576018) has the molecular formula C30H26N2O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[2-ethyl-3-(naphthalen-2-ylmethyl)-8-phenylmethoxyindolizin-1-yl]-2-oxoacetamide.
| Compound Name | 2-[2-ethyl-3-(naphthalen-2-ylmethyl)-8-phenylmethoxyindolizin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 10576018 |
| Molecular Formula | C30H26N2O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 2-[2-ethyl-3-(naphthalen-2-ylmethyl)-8-phenylmethoxyindolizin-1-yl]-2-oxoacetamide |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCc3ccccc3)cccn2c1Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H26N2O3/c1-2-24-25(18-21-14-15-22-11-6-7-12-23(22)17-21)32-16-8-13-26(28(32)27(24)29(33)30(31)34)35-19-20-9-4-3-5-10-20/h3-17H,2,18-19H2,1H3,(H2,31,34) |
| InChIKey | IDETUUKWLQPGSU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|