C27H30ClNO3 — CID 10766033
2-[3-(cycloheptylmethyl)-2-ethyl-8-phenylmethoxyindolizin-1-yl]-2-oxoacetyl chloride (PubChem CID 10766033) has the molecular formula C27H30ClNO3 and a molecular weight of 451.99 g/mol. Its IUPAC name is 2-[3-(cycloheptylmethyl)-2-ethyl-8-phenylmethoxyindolizin-1-yl]-2-oxoacetyl chloride.
| Compound Name | 2-[3-(cycloheptylmethyl)-2-ethyl-8-phenylmethoxyindolizin-1-yl]-2-oxoacetyl chloride |
|---|---|
| PubChem CID | 10766033 |
| Molecular Formula | C27H30ClNO3 |
| Molecular Weight | 451.99 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 2-[3-(cycloheptylmethyl)-2-ethyl-8-phenylmethoxyindolizin-1-yl]-2-oxoacetyl chloride |
| SMILES | CCc1c(C(=O)C(=O)Cl)c2c(OCc3ccccc3)cccn2c1CC1CCCCCC1 |
| InChI | InChI=1S/C27H30ClNO3/c1-2-21-22(17-19-11-6-3-4-7-12-19)29-16-10-15-23(25(29)24(21)26(30)27(28)31)32-18-20-13-8-5-9-14-20/h5,8-10,13-16,19H,2-4,6-7,11-12,17-18H2,1H3 |
| InChIKey | WLOVWYNEZJGZAT-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.99 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|