C32H28N2O3 — CID 10624863
2-[2-ethyl-3-(2-phenylbenzoyl)-8-phenylmethoxyindolizin-1-yl]acetamide (PubChem CID 10624863) has the molecular formula C32H28N2O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 2-[2-ethyl-3-(2-phenylbenzoyl)-8-phenylmethoxyindolizin-1-yl]acetamide.
| Compound Name | 2-[2-ethyl-3-(2-phenylbenzoyl)-8-phenylmethoxyindolizin-1-yl]acetamide |
|---|---|
| PubChem CID | 10624863 |
| Molecular Formula | C32H28N2O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-[2-ethyl-3-(2-phenylbenzoyl)-8-phenylmethoxyindolizin-1-yl]acetamide |
| SMILES | CCc1c(CC(N)=O)c2c(OCc3ccccc3)cccn2c1C(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C32H28N2O3/c1-2-24-27(20-29(33)35)30-28(37-21-22-12-5-3-6-13-22)18-11-19-34(30)31(24)32(36)26-17-10-9-16-25(26)23-14-7-4-8-15-23/h3-19H,2,20-21H2,1H3,(H2,33,35) |
| InChIKey | VCPQIZLHBZJYCW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |