C31H28N2O11 — CID 57001061
2-[[carboxy(hydroxy)methyl]-[2-[8-(carboxymethoxy)-2-ethyl-3-[(2-phenylphenyl)methyl]indolizin-1-yl]-2-oxoacetyl]amino]-2-hydroxyacetic acid (PubChem CID 57001061) has the molecular formula C31H28N2O11 and a molecular weight of 604.57 g/mol. Its IUPAC name is 2-[[carboxy(hydroxy)methyl]-[2-[8-(carboxymethoxy)-2-ethyl-3-[(2-phenylphenyl)methyl]indolizin-1-yl]-2-oxoacetyl]amino]-2-hydroxyacetic acid.
| Compound Name | 2-[[carboxy(hydroxy)methyl]-[2-[8-(carboxymethoxy)-2-ethyl-3-[(2-phenylphenyl)methyl]indolizin-1-yl]-2-oxoacetyl]amino]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 57001061 |
| Molecular Formula | C31H28N2O11 |
| Molecular Weight | 604.57 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | 2-[[carboxy(hydroxy)methyl]-[2-[8-(carboxymethoxy)-2-ethyl-3-[(2-phenylphenyl)methyl]indolizin-1-yl]-2-oxoacetyl]amino]-2-hydroxyacetic acid |
| SMILES | CCc1c(C(=O)C(=O)N(C(O)C(=O)O)C(O)C(=O)O)c2c(OCC(=O)O)cccn2c1Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C31H28N2O11/c1-2-19-21(15-18-11-6-7-12-20(18)17-9-4-3-5-10-17)32-14-8-13-22(44-16-23(34)35)25(32)24(19)26(36)27(37)33(28(38)30(40)41)29(39)31(42)43/h3-14,28-29,38-39H,2,15-16H2,1H3,(H,34,35)(H,40,41)(H,42,43) |
| InChIKey | YHNOZIOUQHZLIM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 203.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|