C36H38N2O7 — CID 18771217
(1-methylcyclopentyl) 2-[2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetyl]oxypropanoate (PubChem CID 18771217) has the molecular formula C36H38N2O7 and a molecular weight of 610.71 g/mol. Its IUPAC name is (1-methylcyclopentyl) 2-[2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetyl]oxypropanoate.
| Compound Name | (1-methylcyclopentyl) 2-[2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetyl]oxypropanoate |
|---|---|
| PubChem CID | 18771217 |
| Molecular Formula | C36H38N2O7 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | (1-methylcyclopentyl) 2-[2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetyl]oxypropanoate |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)OC(C)C(=O)OC3(C)CCCC3)cccn2c1Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C36H38N2O7/c1-4-26-28(21-25-15-8-9-16-27(25)24-13-6-5-7-14-24)38-20-12-17-29(32(38)31(26)33(40)34(37)41)43-22-30(39)44-23(2)35(42)45-36(3)18-10-11-19-36/h5-9,12-17,20,23H,4,10-11,18-19,21-22H2,1-3H3,(H2,37,41) |
| InChIKey | MRRHEOGBNQINCD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|