C27H24N2O5 — CID 54321841
2-[2-ethyl-1-(oxaldehydoylamino)-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetic acid (PubChem CID 54321841) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[2-ethyl-1-(oxaldehydoylamino)-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetic acid.
| Compound Name | 2-[2-ethyl-1-(oxaldehydoylamino)-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetic acid |
|---|---|
| PubChem CID | 54321841 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-[2-ethyl-1-(oxaldehydoylamino)-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetic acid |
| SMILES | CCc1c(NC(=O)C=O)c2c(OCC(=O)O)cccn2c1Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C27H24N2O5/c1-2-20-22(15-19-11-6-7-12-21(19)18-9-4-3-5-10-18)29-14-8-13-23(34-17-25(32)33)27(29)26(20)28-24(31)16-30/h3-14,16H,2,15,17H2,1H3,(H,28,31)(H,32,33) |
| InChIKey | SSFABLJYJSYFFK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|