C34H27N3O3 — CID 18771269
2-[2-methyl-3-[(2-phenylphenyl)methyl]-8-(quinolin-2-ylmethoxy)indolizin-1-yl]-2-oxoacetamide (PubChem CID 18771269) has the molecular formula C34H27N3O3 and a molecular weight of 525.61 g/mol. Its IUPAC name is 2-[2-methyl-3-[(2-phenylphenyl)methyl]-8-(quinolin-2-ylmethoxy)indolizin-1-yl]-2-oxoacetamide.
| Compound Name | 2-[2-methyl-3-[(2-phenylphenyl)methyl]-8-(quinolin-2-ylmethoxy)indolizin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 18771269 |
| Molecular Formula | C34H27N3O3 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 2-[2-methyl-3-[(2-phenylphenyl)methyl]-8-(quinolin-2-ylmethoxy)indolizin-1-yl]-2-oxoacetamide |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OCc3ccc4ccccc4n3)cccn2c1Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C34H27N3O3/c1-22-29(20-25-13-5-7-14-27(25)23-10-3-2-4-11-23)37-19-9-16-30(32(37)31(22)33(38)34(35)39)40-21-26-18-17-24-12-6-8-15-28(24)36-26/h2-19H,20-21H2,1H3,(H2,35,39) |
| InChIKey | ZVAFUADPAJWMSG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|