About 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate
2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate (PubChem CID 18771215) has the molecular formula C30H28N2O6
and a molecular weight of 512.56 g/mol. Its IUPAC name is 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate.
Molecular Properties
| Compound Name | 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate |
| PubChem CID | 18771215 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)OCC(C)=O)cccn2c1Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C30H28N2O6/c1-3-22-24(16-21-12-7-8-13-23(21)20-10-5-4-6-11-20)32-15-9-14-25(28(32)27(22)29(35)30(31)36)37-18-26(34)38-17-19(2)33/h4-15H,3,16-18H2,1-2H3,(H2,31,36) |
| InChIKey | PTNAIDJQEOFHCI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate?
The IUPAC name of 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate (CID 18771215) is 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate.
What is the SMILES notation for 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate?
The canonical SMILES for 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate is CCc1c(C(=O)C(N)=O)c2c(OCC(=O)OCC(C)=O)cccn2c1Cc1ccccc1-c1ccccc1.
What is the InChIKey of 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate?
The InChIKey is PTNAIDJQEOFHCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28N2O6/c1-3-22-24(16-21-12-7-8-13-23(21)20-10-5-4-6-11-20)32-15-9-14-25(28(32)27(22)29(35)30(31)36)37-18-26(34)38-17-19(2)33/h4-15H,3,16-18H2,1-2H3,(H2,31,36).
What are the key properties of 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate?
2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate has a molecular weight of 512.56 g/mol, XLogP of 3.94, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl 2-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-8-yl]oxyacetate is sourced from PubChem (CID 18771215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).