C20H26N2O5 — CID 10690818
methyl 2-(2-ethyl-1-oxamoyl-3-pentylindolizin-8-yl)oxyacetate (PubChem CID 10690818) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is methyl 2-(2-ethyl-1-oxamoyl-3-pentylindolizin-8-yl)oxyacetate.
| Compound Name | methyl 2-(2-ethyl-1-oxamoyl-3-pentylindolizin-8-yl)oxyacetate |
|---|---|
| PubChem CID | 10690818 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | methyl 2-(2-ethyl-1-oxamoyl-3-pentylindolizin-8-yl)oxyacetate |
| SMILES | CCCCCc1c(CC)c(C(=O)C(N)=O)c2c(OCC(=O)OC)cccn12 |
| InChI | InChI=1S/C20H26N2O5/c1-4-6-7-9-14-13(5-2)17(19(24)20(21)25)18-15(10-8-11-22(14)18)27-12-16(23)26-3/h8,10-11H,4-7,9,12H2,1-3H3,(H2,21,25) |
| InChIKey | UXURZSVBUIIAPD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|