C21H19ClN6O3 — CID 10531659
2-[3-[(3-chlorophenyl)methyl]-2-ethyl-8-(2H-tetrazol-5-ylmethoxy)indolizin-1-yl]-2-oxoacetamide (PubChem CID 10531659) has the molecular formula C21H19ClN6O3 and a molecular weight of 438.88 g/mol. Its IUPAC name is 2-[3-[(3-chlorophenyl)methyl]-2-ethyl-8-(2H-tetrazol-5-ylmethoxy)indolizin-1-yl]-2-oxoacetamide.
| Compound Name | 2-[3-[(3-chlorophenyl)methyl]-2-ethyl-8-(2H-tetrazol-5-ylmethoxy)indolizin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 10531659 |
| Molecular Formula | C21H19ClN6O3 |
| Molecular Weight | 438.88 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 2-[3-[(3-chlorophenyl)methyl]-2-ethyl-8-(2H-tetrazol-5-ylmethoxy)indolizin-1-yl]-2-oxoacetamide |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCc3nn[nH]n3)cccn2c1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H19ClN6O3/c1-2-14-15(10-12-5-3-6-13(22)9-12)28-8-4-7-16(31-11-17-24-26-27-25-17)19(28)18(14)20(29)21(23)30/h3-9H,2,10-11H2,1H3,(H2,23,30)(H,24,25,26,27) |
| InChIKey | LSVWPQNNKATYSR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.88 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|