C25H26ClNO3 — CID 10669989
2-[3-(cyclopentylmethyl)-2-ethyl-8-phenylmethoxyindolizin-1-yl]-2-oxoacetyl chloride (PubChem CID 10669989) has the molecular formula C25H26ClNO3 and a molecular weight of 423.94 g/mol. Its IUPAC name is 2-[3-(cyclopentylmethyl)-2-ethyl-8-phenylmethoxyindolizin-1-yl]-2-oxoacetyl chloride.
| Compound Name | 2-[3-(cyclopentylmethyl)-2-ethyl-8-phenylmethoxyindolizin-1-yl]-2-oxoacetyl chloride |
|---|---|
| PubChem CID | 10669989 |
| Molecular Formula | C25H26ClNO3 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-[3-(cyclopentylmethyl)-2-ethyl-8-phenylmethoxyindolizin-1-yl]-2-oxoacetyl chloride |
| SMILES | CCc1c(C(=O)C(=O)Cl)c2c(OCc3ccccc3)cccn2c1CC1CCCC1 |
| InChI | InChI=1S/C25H26ClNO3/c1-2-19-20(15-17-9-6-7-10-17)27-14-8-13-21(23(27)22(19)24(28)25(26)29)30-16-18-11-4-3-5-12-18/h3-5,8,11-14,17H,2,6-7,9-10,15-16H2,1H3 |
| InChIKey | UARFHDDBOYUFLK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|