C21H21NO5S — CID 10739702
diethyl 8-phenylmethoxy-2-sulfanylindolizine-1,3-dicarboxylate (PubChem CID 10739702) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is diethyl 8-phenylmethoxy-2-sulfanylindolizine-1,3-dicarboxylate.
| Compound Name | diethyl 8-phenylmethoxy-2-sulfanylindolizine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10739702 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | diethyl 8-phenylmethoxy-2-sulfanylindolizine-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c(S)c(C(=O)OCC)n2cccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C21H21NO5S/c1-3-25-20(23)16-17-15(27-13-14-9-6-5-7-10-14)11-8-12-22(17)18(19(16)28)21(24)26-4-2/h5-12,28H,3-4,13H2,1-2H3 |
| InChIKey | OJSXIKGZGWRNGL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|