C24H22O6 — CID 156760748
4-ethoxycarbonyl-2,5-bis(phenylmethoxy)benzoic acid (PubChem CID 156760748) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is 4-ethoxycarbonyl-2,5-bis(phenylmethoxy)benzoic acid.
| Compound Name | 4-ethoxycarbonyl-2,5-bis(phenylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 156760748 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-ethoxycarbonyl-2,5-bis(phenylmethoxy)benzoic acid |
| SMILES | CCOC(=O)c1cc(OCc2ccccc2)c(C(=O)O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C24H22O6/c1-2-28-24(27)20-14-21(29-15-17-9-5-3-6-10-17)19(23(25)26)13-22(20)30-16-18-11-7-4-8-12-18/h3-14H,2,15-16H2,1H3,(H,25,26) |
| InChIKey | UPJJKSJMEHSWOF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |