C27H37BrN2O4 — CID 142279153
ethyl 5-(8-bromooctoxy)-4-(N'-ethylcarbamimidoyl)-2-phenylmethoxybenzoate (PubChem CID 142279153) has the molecular formula C27H37BrN2O4 and a molecular weight of 533.51 g/mol. Its IUPAC name is ethyl 5-(8-bromooctoxy)-4-(N'-ethylcarbamimidoyl)-2-phenylmethoxybenzoate.
| Compound Name | ethyl 5-(8-bromooctoxy)-4-(N'-ethylcarbamimidoyl)-2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 142279153 |
| Molecular Formula | C27H37BrN2O4 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | ethyl 5-(8-bromooctoxy)-4-(N'-ethylcarbamimidoyl)-2-phenylmethoxybenzoate |
| SMILES | CC/N=C(\N)c1cc(OCc2ccccc2)c(C(=O)OCC)cc1OCCCCCCCCBr |
| InChI | InChI=1S/C27H37BrN2O4/c1-3-30-26(29)22-18-25(34-20-21-14-10-9-11-15-21)23(27(31)32-4-2)19-24(22)33-17-13-8-6-5-7-12-16-28/h9-11,14-15,18-19H,3-8,12-13,16-17,20H2,1-2H3,(H2,29,30) |
| InChIKey | PIWLDKBLDCVEDT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|