C33H32N2O7 — CID 156852371
ethyl 4-[(2-amino-6-ethoxycarbonylphenyl)carbamoyl]-2,5-bis(phenylmethoxy)benzoate (PubChem CID 156852371) has the molecular formula C33H32N2O7 and a molecular weight of 568.63 g/mol. Its IUPAC name is ethyl 4-[(2-amino-6-ethoxycarbonylphenyl)carbamoyl]-2,5-bis(phenylmethoxy)benzoate.
| Compound Name | ethyl 4-[(2-amino-6-ethoxycarbonylphenyl)carbamoyl]-2,5-bis(phenylmethoxy)benzoate |
|---|---|
| PubChem CID | 156852371 |
| Molecular Formula | C33H32N2O7 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | ethyl 4-[(2-amino-6-ethoxycarbonylphenyl)carbamoyl]-2,5-bis(phenylmethoxy)benzoate |
| SMILES | CCOC(=O)c1cc(OCc2ccccc2)c(C(=O)Nc2c(N)cccc2C(=O)OCC)cc1OCc1ccccc1 |
| InChI | InChI=1S/C33H32N2O7/c1-3-39-32(37)24-16-11-17-27(34)30(24)35-31(36)25-18-29(42-21-23-14-9-6-10-15-23)26(33(38)40-4-2)19-28(25)41-20-22-12-7-5-8-13-22/h5-19H,3-4,20-21,34H2,1-2H3,(H,35,36) |
| InChIKey | IPDMHTNFIMUQEE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|