C23H24N2O5 — CID 10740206
4-(3-benzyl-2-ethyl-1-oxamoylindolizin-7-yl)oxybutanoic acid (PubChem CID 10740206) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 4-(3-benzyl-2-ethyl-1-oxamoylindolizin-7-yl)oxybutanoic acid.
| Compound Name | 4-(3-benzyl-2-ethyl-1-oxamoylindolizin-7-yl)oxybutanoic acid |
|---|---|
| PubChem CID | 10740206 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 4-(3-benzyl-2-ethyl-1-oxamoylindolizin-7-yl)oxybutanoic acid |
| SMILES | CCc1c(C(=O)C(N)=O)c2cc(OCCCC(=O)O)ccn2c1Cc1ccccc1 |
| InChI | InChI=1S/C23H24N2O5/c1-2-17-18(13-15-7-4-3-5-8-15)25-11-10-16(30-12-6-9-20(26)27)14-19(25)21(17)22(28)23(24)29/h3-5,7-8,10-11,14H,2,6,9,12-13H2,1H3,(H2,24,29)(H,26,27) |
| InChIKey | BNOLULAOIMKFFY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|