C23H26N2O4 — CID 10620653
5-[3-(2-amino-2-oxoethyl)-1-benzyl-2-methylindol-5-yl]oxypentanoic acid (PubChem CID 10620653) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 5-[3-(2-amino-2-oxoethyl)-1-benzyl-2-methylindol-5-yl]oxypentanoic acid.
| Compound Name | 5-[3-(2-amino-2-oxoethyl)-1-benzyl-2-methylindol-5-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 10620653 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 5-[3-(2-amino-2-oxoethyl)-1-benzyl-2-methylindol-5-yl]oxypentanoic acid |
| SMILES | Cc1c(CC(N)=O)c2cc(OCCCCC(=O)O)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C23H26N2O4/c1-16-19(14-22(24)26)20-13-18(29-12-6-5-9-23(27)28)10-11-21(20)25(16)15-17-7-3-2-4-8-17/h2-4,7-8,10-11,13H,5-6,9,12,14-15H2,1H3,(H2,24,26)(H,27,28) |
| InChIKey | MBATZGDXOVMVDM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|