C23H29N2O5P — CID 10623151
3-[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethylindol-5-yl]oxypropyl-methoxyphosphinic acid (PubChem CID 10623151) has the molecular formula C23H29N2O5P and a molecular weight of 444.47 g/mol. Its IUPAC name is 3-[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethylindol-5-yl]oxypropyl-methoxyphosphinic acid.
| Compound Name | 3-[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethylindol-5-yl]oxypropyl-methoxyphosphinic acid |
|---|---|
| PubChem CID | 10623151 |
| Molecular Formula | C23H29N2O5P |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 3-[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethylindol-5-yl]oxypropyl-methoxyphosphinic acid |
| SMILES | CCc1c(CC(N)=O)c2cc(OCCCP(=O)(O)OC)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C23H29N2O5P/c1-3-21-20(15-23(24)26)19-14-18(30-12-7-13-31(27,28)29-2)10-11-22(19)25(21)16-17-8-5-4-6-9-17/h4-6,8-11,14H,3,7,12-13,15-16H2,1-2H3,(H2,24,26)(H,27,28) |
| InChIKey | BFHXFKUYCLKMIL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|