C24H28N2O4 — CID 10573508
methyl 5-[3-(2-amino-2-oxoethyl)-1-benzyl-2-methylindol-5-yl]oxypentanoate (PubChem CID 10573508) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is methyl 5-[3-(2-amino-2-oxoethyl)-1-benzyl-2-methylindol-5-yl]oxypentanoate.
| Compound Name | methyl 5-[3-(2-amino-2-oxoethyl)-1-benzyl-2-methylindol-5-yl]oxypentanoate |
|---|---|
| PubChem CID | 10573508 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | methyl 5-[3-(2-amino-2-oxoethyl)-1-benzyl-2-methylindol-5-yl]oxypentanoate |
| SMILES | COC(=O)CCCCOc1ccc2c(c1)c(CC(N)=O)c(C)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H28N2O4/c1-17-20(15-23(25)27)21-14-19(30-13-7-6-10-24(28)29-2)11-12-22(21)26(17)16-18-8-4-3-5-9-18/h3-5,8-9,11-12,14H,6-7,10,13,15-16H2,1-2H3,(H2,25,27) |
| InChIKey | SNEWZCOUCBNARQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|