C45H52N4O6 — CID 24860466
2-[1-[[2-[7-[2-[[3-(2-amino-2-oxoethyl)-5-methoxy-2-methylindol-1-yl]methyl]phenoxy]heptoxy]phenyl]methyl]-5-methoxy-2-methylindol-3-yl]acetamide (PubChem CID 24860466) has the molecular formula C45H52N4O6 and a molecular weight of 744.93 g/mol. Its IUPAC name is 2-[1-[[2-[7-[2-[[3-(2-amino-2-oxoethyl)-5-methoxy-2-methylindol-1-yl]methyl]phenoxy]heptoxy]phenyl]methyl]-5-methoxy-2-methylindol-3-yl]acetamide.
| Compound Name | 2-[1-[[2-[7-[2-[[3-(2-amino-2-oxoethyl)-5-methoxy-2-methylindol-1-yl]methyl]phenoxy]heptoxy]phenyl]methyl]-5-methoxy-2-methylindol-3-yl]acetamide |
|---|---|
| PubChem CID | 24860466 |
| Molecular Formula | C45H52N4O6 |
| Molecular Weight | 744.93 g/mol |
| Exact Mass | 744.39 |
| IUPAC Name | 2-[1-[[2-[7-[2-[[3-(2-amino-2-oxoethyl)-5-methoxy-2-methylindol-1-yl]methyl]phenoxy]heptoxy]phenyl]methyl]-5-methoxy-2-methylindol-3-yl]acetamide |
| SMILES | COc1ccc2c(c1)c(CC(N)=O)c(C)n2Cc1ccccc1OCCCCCCCOc1ccccc1Cn1c(C)c(CC(N)=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C45H52N4O6/c1-30-36(26-44(46)50)38-24-34(52-3)18-20-40(38)48(30)28-32-14-8-10-16-42(32)54-22-12-6-5-7-13-23-55-43-17-11-9-15-33(43)29-49-31(2)37(27-45(47)51)39-25-35(53-4)19-21-41(39)49/h8-11,14-21,24-25H,5-7,12-13,22-23,26-29H2,1-4H3,(H2,46,50)(H2,47,51) |
| InChIKey | ABMIXBHOXNQPBZ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.93 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|