C35H34N4O4 — CID 73056339
2-[1-[[2-[2-[2-[anilino(cyano)methyl]phenoxy]ethoxy]phenyl]methyl]-5-methoxy-2-methylindol-3-yl]acetamide (PubChem CID 73056339) has the molecular formula C35H34N4O4 and a molecular weight of 574.68 g/mol. Its IUPAC name is 2-[1-[[2-[2-[2-[anilino(cyano)methyl]phenoxy]ethoxy]phenyl]methyl]-5-methoxy-2-methylindol-3-yl]acetamide.
| Compound Name | 2-[1-[[2-[2-[2-[anilino(cyano)methyl]phenoxy]ethoxy]phenyl]methyl]-5-methoxy-2-methylindol-3-yl]acetamide |
|---|---|
| PubChem CID | 73056339 |
| Molecular Formula | C35H34N4O4 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 2-[1-[[2-[2-[2-[anilino(cyano)methyl]phenoxy]ethoxy]phenyl]methyl]-5-methoxy-2-methylindol-3-yl]acetamide |
| SMILES | COc1ccc2c(c1)c(CC(N)=O)c(C)n2Cc1ccccc1OCCOc1ccccc1C(C#N)Nc1ccccc1 |
| InChI | InChI=1S/C35H34N4O4/c1-24-29(21-35(37)40)30-20-27(41-2)16-17-32(30)39(24)23-25-10-6-8-14-33(25)42-18-19-43-34-15-9-7-13-28(34)31(22-36)38-26-11-4-3-5-12-26/h3-17,20,31,38H,18-19,21,23H2,1-2H3,(H2,37,40) |
| InChIKey | NDHXQAINCCNHRH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|