C20H24N2O4P+ — CID 173270913
3-[3-(aminomethyl)-1-benzyl-2-methylindol-5-yl]oxypropoxy-hydroxy-oxophosphanium (PubChem CID 173270913) has the molecular formula C20H24N2O4P+ and a molecular weight of 387.40 g/mol. Its IUPAC name is 3-[3-(aminomethyl)-1-benzyl-2-methylindol-5-yl]oxypropoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[3-(aminomethyl)-1-benzyl-2-methylindol-5-yl]oxypropoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 173270913 |
| Molecular Formula | C20H24N2O4P+ |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 3-[3-(aminomethyl)-1-benzyl-2-methylindol-5-yl]oxypropoxy-hydroxy-oxophosphanium |
| SMILES | Cc1c(CN)c2cc(OCCCO[P+](=O)O)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C20H23N2O4P/c1-15-19(13-21)18-12-17(25-10-5-11-26-27(23)24)8-9-20(18)22(15)14-16-6-3-2-4-7-16/h2-4,6-9,12H,5,10-11,13-14,21H2,1H3/p+1 |
| InChIKey | LWYPEOTXXNZHEP-UHFFFAOYSA-O |
| XLogP | 3.89 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|