C23H28NO5P — CID 20667723
3-[1-benzyl-2-ethyl-3-(2-oxopropyl)indol-5-yl]oxypropylphosphonic acid (PubChem CID 20667723) has the molecular formula C23H28NO5P and a molecular weight of 429.45 g/mol. Its IUPAC name is 3-[1-benzyl-2-ethyl-3-(2-oxopropyl)indol-5-yl]oxypropylphosphonic acid.
| Compound Name | 3-[1-benzyl-2-ethyl-3-(2-oxopropyl)indol-5-yl]oxypropylphosphonic acid |
|---|---|
| PubChem CID | 20667723 |
| Molecular Formula | C23H28NO5P |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3-[1-benzyl-2-ethyl-3-(2-oxopropyl)indol-5-yl]oxypropylphosphonic acid |
| SMILES | CCc1c(CC(C)=O)c2cc(OCCCP(=O)(O)O)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C23H28NO5P/c1-3-22-20(14-17(2)25)21-15-19(29-12-7-13-30(26,27)28)10-11-23(21)24(22)16-18-8-5-4-6-9-18/h4-6,8-11,15H,3,7,12-14,16H2,1-2H3,(H2,26,27,28) |
| InChIKey | CBSQTRPZWPDVTP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|