C24H29N3O2 — CID 15837958
2-(1-benzyl-5-cyclopentyloxy-2-ethylindol-3-yl)acetohydrazide (PubChem CID 15837958) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-(1-benzyl-5-cyclopentyloxy-2-ethylindol-3-yl)acetohydrazide.
| Compound Name | 2-(1-benzyl-5-cyclopentyloxy-2-ethylindol-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 15837958 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2-(1-benzyl-5-cyclopentyloxy-2-ethylindol-3-yl)acetohydrazide |
| SMILES | CCc1c(CC(=O)NN)c2cc(OC3CCCC3)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C24H29N3O2/c1-2-22-21(15-24(28)26-25)20-14-19(29-18-10-6-7-11-18)12-13-23(20)27(22)16-17-8-4-3-5-9-17/h3-5,8-9,12-14,18H,2,6-7,10-11,15-16,25H2,1H3,(H,26,28) |
| InChIKey | GTRGZMPVGRXOSM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|