C21H21NO3 — CID 21191871
2-(1-benzyl-2-cyclopropyl-5-methoxyindol-3-yl)acetic acid (PubChem CID 21191871) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-(1-benzyl-2-cyclopropyl-5-methoxyindol-3-yl)acetic acid.
| Compound Name | 2-(1-benzyl-2-cyclopropyl-5-methoxyindol-3-yl)acetic acid |
|---|---|
| PubChem CID | 21191871 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-(1-benzyl-2-cyclopropyl-5-methoxyindol-3-yl)acetic acid |
| SMILES | COc1ccc2c(c1)c(CC(=O)O)c(C1CC1)n2Cc1ccccc1 |
| InChI | InChI=1S/C21H21NO3/c1-25-16-9-10-19-17(11-16)18(12-20(23)24)21(15-7-8-15)22(19)13-14-5-3-2-4-6-14/h2-6,9-11,15H,7-8,12-13H2,1H3,(H,23,24) |
| InChIKey | FRWNLQYANMCMPF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |