C24H20FNO3 — CID 67649862
2-[1-benzyl-2-(4-fluorophenyl)-5-methoxyindol-3-yl]acetic acid (PubChem CID 67649862) has the molecular formula C24H20FNO3 and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-[1-benzyl-2-(4-fluorophenyl)-5-methoxyindol-3-yl]acetic acid.
| Compound Name | 2-[1-benzyl-2-(4-fluorophenyl)-5-methoxyindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 67649862 |
| Molecular Formula | C24H20FNO3 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-[1-benzyl-2-(4-fluorophenyl)-5-methoxyindol-3-yl]acetic acid |
| SMILES | COc1ccc2c(c1)c(CC(=O)O)c(-c1ccc(F)cc1)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H20FNO3/c1-29-19-11-12-22-20(13-19)21(14-23(27)28)24(17-7-9-18(25)10-8-17)26(22)15-16-5-3-2-4-6-16/h2-13H,14-15H2,1H3,(H,27,28) |
| InChIKey | CDJWEWZPWZTAKD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |