C28H26N2O4 — CID 67727130
methyl 2-[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethylindole-5-carbonyl]benzoate (PubChem CID 67727130) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is methyl 2-[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethylindole-5-carbonyl]benzoate.
| Compound Name | methyl 2-[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethylindole-5-carbonyl]benzoate |
|---|---|
| PubChem CID | 67727130 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | methyl 2-[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethylindole-5-carbonyl]benzoate |
| SMILES | CCc1c(CC(N)=O)c2cc(C(=O)c3ccccc3C(=O)OC)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C28H26N2O4/c1-3-24-23(16-26(29)31)22-15-19(27(32)20-11-7-8-12-21(20)28(33)34-2)13-14-25(22)30(24)17-18-9-5-4-6-10-18/h4-15H,3,16-17H2,1-2H3,(H2,29,31) |
| InChIKey | IHVZTQGCTWJNCZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|