C22H26N2O4 — CID 70918056
4-[[3-(2-amino-2-oxoethyl)-1-benzyl-2-methyl-2,3-dihydroindol-5-yl]oxy]butanoic acid (PubChem CID 70918056) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 4-[[3-(2-amino-2-oxoethyl)-1-benzyl-2-methyl-2,3-dihydroindol-5-yl]oxy]butanoic acid.
| Compound Name | 4-[[3-(2-amino-2-oxoethyl)-1-benzyl-2-methyl-2,3-dihydroindol-5-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 70918056 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 4-[[3-(2-amino-2-oxoethyl)-1-benzyl-2-methyl-2,3-dihydroindol-5-yl]oxy]butanoic acid |
| SMILES | CC1C(CC(N)=O)c2cc(OCCCC(=O)O)ccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C22H26N2O4/c1-15-18(13-21(23)25)19-12-17(28-11-5-8-22(26)27)9-10-20(19)24(15)14-16-6-3-2-4-7-16/h2-4,6-7,9-10,12,15,18H,5,8,11,13-14H2,1H3,(H2,23,25)(H,26,27) |
| InChIKey | XRNYMDMHYKYJPE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|