C28H28N2O4 — CID 10139191
2-[(9-benzyl-5-carbamoyl-4b,5,6,7,8,8a-hexahydrocarbazol-3-yl)oxymethyl]benzoic acid (PubChem CID 10139191) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[(9-benzyl-5-carbamoyl-4b,5,6,7,8,8a-hexahydrocarbazol-3-yl)oxymethyl]benzoic acid.
| Compound Name | 2-[(9-benzyl-5-carbamoyl-4b,5,6,7,8,8a-hexahydrocarbazol-3-yl)oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 10139191 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 2-[(9-benzyl-5-carbamoyl-4b,5,6,7,8,8a-hexahydrocarbazol-3-yl)oxymethyl]benzoic acid |
| SMILES | NC(=O)C1CCCC2C1c1cc(OCc3ccccc3C(=O)O)ccc1N2Cc1ccccc1 |
| InChI | InChI=1S/C28H28N2O4/c29-27(31)22-11-6-12-25-26(22)23-15-20(34-17-19-9-4-5-10-21(19)28(32)33)13-14-24(23)30(25)16-18-7-2-1-3-8-18/h1-5,7-10,13-15,22,25-26H,6,11-12,16-17H2,(H2,29,31)(H,32,33) |
| InChIKey | YCGWRUVGMXUVPJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|