C27H27NO5 — CID 58347900
2-[2-oxo-2-[4-(4-phenylmethoxyphenoxy)piperidin-1-yl]ethyl]benzoic acid (PubChem CID 58347900) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[2-oxo-2-[4-(4-phenylmethoxyphenoxy)piperidin-1-yl]ethyl]benzoic acid.
| Compound Name | 2-[2-oxo-2-[4-(4-phenylmethoxyphenoxy)piperidin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 58347900 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-[2-oxo-2-[4-(4-phenylmethoxyphenoxy)piperidin-1-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CC(=O)N1CCC(Oc2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C27H27NO5/c29-26(18-21-8-4-5-9-25(21)27(30)31)28-16-14-24(15-17-28)33-23-12-10-22(11-13-23)32-19-20-6-2-1-3-7-20/h1-13,24H,14-19H2,(H,30,31) |
| InChIKey | LWHAQPTWPVKOIQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |