C27H25F2NO3 — CID 84561773
(E)-1-[4-(3,4-difluorophenoxy)piperidin-1-yl]-3-(4-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 84561773) has the molecular formula C27H25F2NO3 and a molecular weight of 449.50 g/mol. Its IUPAC name is (E)-1-[4-(3,4-difluorophenoxy)piperidin-1-yl]-3-(4-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(3,4-difluorophenoxy)piperidin-1-yl]-3-(4-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 84561773 |
| Molecular Formula | C27H25F2NO3 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (E)-1-[4-(3,4-difluorophenoxy)piperidin-1-yl]-3-(4-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OCc2ccccc2)cc1)N1CCC(Oc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C27H25F2NO3/c28-25-12-11-24(18-26(25)29)33-23-14-16-30(17-15-23)27(31)13-8-20-6-9-22(10-7-20)32-19-21-4-2-1-3-5-21/h1-13,18,23H,14-17,19H2/b13-8+ |
| InChIKey | RJSPOSNVAYWGMR-MDWZMJQESA-N |
| XLogP | 5.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|