C24H25N3O3 — CID 76865457
1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-3-(4-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 76865457) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-3-(4-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-3-(4-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 76865457 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-3-(4-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | Cc1noc(C2CCN(C(=O)C=Cc3ccc(OCc4ccccc4)cc3)CC2)n1 |
| InChI | InChI=1S/C24H25N3O3/c1-18-25-24(30-26-18)21-13-15-27(16-14-21)23(28)12-9-19-7-10-22(11-8-19)29-17-20-5-3-2-4-6-20/h2-12,21H,13-17H2,1H3 |
| InChIKey | UCFQSCOBBQRONG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|