C23H25F2NO3 — CID 84561806
(E)-1-[4-(3,4-difluorophenoxy)piperidin-1-yl]-3-(4-propoxyphenyl)prop-2-en-1-one (PubChem CID 84561806) has the molecular formula C23H25F2NO3 and a molecular weight of 401.45 g/mol. Its IUPAC name is (E)-1-[4-(3,4-difluorophenoxy)piperidin-1-yl]-3-(4-propoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(3,4-difluorophenoxy)piperidin-1-yl]-3-(4-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 84561806 |
| Molecular Formula | C23H25F2NO3 |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (E)-1-[4-(3,4-difluorophenoxy)piperidin-1-yl]-3-(4-propoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1ccc(/C=C/C(=O)N2CCC(Oc3ccc(F)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C23H25F2NO3/c1-2-15-28-18-6-3-17(4-7-18)5-10-23(27)26-13-11-19(12-14-26)29-20-8-9-21(24)22(25)16-20/h3-10,16,19H,2,11-15H2,1H3/b10-5+ |
| InChIKey | AHQKVBXBNVNXQA-BJMVGYQFSA-N |
| XLogP | 4.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|