C16H23N3O2 — CID 82365942
(E)-1-(4-aminopiperazin-1-yl)-3-(4-propoxyphenyl)prop-2-en-1-one (PubChem CID 82365942) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (E)-1-(4-aminopiperazin-1-yl)-3-(4-propoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-aminopiperazin-1-yl)-3-(4-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 82365942 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (E)-1-(4-aminopiperazin-1-yl)-3-(4-propoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1ccc(/C=C/C(=O)N2CCN(N)CC2)cc1 |
| InChI | InChI=1S/C16H23N3O2/c1-2-13-21-15-6-3-14(4-7-15)5-8-16(20)18-9-11-19(17)12-10-18/h3-8H,2,9-13,17H2,1H3/b8-5+ |
| InChIKey | WGAFGDFGRHXISF-VMPITWQZSA-N |
| XLogP | 1.51 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|