C25H23NO3 — CID 154447443
2-[2-ethyl-3-[(4-phenylphenyl)methyl]indolizin-8-yl]oxyacetic acid (PubChem CID 154447443) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-[2-ethyl-3-[(4-phenylphenyl)methyl]indolizin-8-yl]oxyacetic acid.
| Compound Name | 2-[2-ethyl-3-[(4-phenylphenyl)methyl]indolizin-8-yl]oxyacetic acid |
|---|---|
| PubChem CID | 154447443 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[2-ethyl-3-[(4-phenylphenyl)methyl]indolizin-8-yl]oxyacetic acid |
| SMILES | CCc1cc2c(OCC(=O)O)cccn2c1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23NO3/c1-2-19-16-23-24(29-17-25(27)28)9-6-14-26(23)22(19)15-18-10-12-21(13-11-18)20-7-4-3-5-8-20/h3-14,16H,2,15,17H2,1H3,(H,27,28) |
| InChIKey | OROKZJSEDLJTNW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |