C24H34N2O5 — CID 142170560
formamide;methyl 2-[3-acetyl-2-ethyl-1-[(E)-2-methylbut-2-enyl]indol-4-yl]oxyacetate;prop-1-ene (PubChem CID 142170560) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is formamide;methyl 2-[3-acetyl-2-ethyl-1-[(E)-2-methylbut-2-enyl]indol-4-yl]oxyacetate;prop-1-ene.
| Compound Name | formamide;methyl 2-[3-acetyl-2-ethyl-1-[(E)-2-methylbut-2-enyl]indol-4-yl]oxyacetate;prop-1-ene |
|---|---|
| PubChem CID | 142170560 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | formamide;methyl 2-[3-acetyl-2-ethyl-1-[(E)-2-methylbut-2-enyl]indol-4-yl]oxyacetate;prop-1-ene |
| SMILES | C/C=C(\C)Cn1c(CC)c(C(C)=O)c2c(OCC(=O)OC)cccc21.C=CC.NC=O |
| InChI | InChI=1S/C20H25NO4.C3H6.CH3NO/c1-6-13(3)11-21-15(7-2)19(14(4)22)20-16(21)9-8-10-17(20)25-12-18(23)24-5;1-3-2;2-1-3/h6,8-10H,7,11-12H2,1-5H3;3H,1H2,2H3;1H,(H2,2,3)/b13-6+;; |
| InChIKey | LGXWDQLKDFKTSQ-JNXPPIHMSA-N |
| XLogP | 4.22 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|