C22H22N2O5 — CID 56925188
trideuteriomethyl 2-[1-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-2-ethyl-3-oxamoylindol-4-yl]oxyacetate (PubChem CID 56925188) has the molecular formula C22H22N2O5 and a molecular weight of 404.49 g/mol. Its IUPAC name is trideuteriomethyl 2-[1-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-2-ethyl-3-oxamoylindol-4-yl]oxyacetate.
| Compound Name | trideuteriomethyl 2-[1-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-2-ethyl-3-oxamoylindol-4-yl]oxyacetate |
|---|---|
| PubChem CID | 56925188 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | trideuteriomethyl 2-[1-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-2-ethyl-3-oxamoylindol-4-yl]oxyacetate |
| SMILES | [2H]c1c([2H])c([2H])c(C([2H])([2H])n2c(CC)c(C(=O)C(N)=O)c3c(OCC(=O)OC([2H])([2H])[2H])cccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C22H22N2O5/c1-3-15-20(21(26)22(23)27)19-16(24(15)12-14-8-5-4-6-9-14)10-7-11-17(19)29-13-18(25)28-2/h4-11H,3,12-13H2,1-2H3,(H2,23,27)/i2D3,4D,5D,6D,8D,9D,12D2 |
| InChIKey | VJYDOJXJUCJUHL-JNMYLXLSSA-N |
| XLogP | 2.47 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|