C28H32N2O5 — CID 142170559
2-[2-ethyl-1-[(3-methyl-2-phenylcyclohexyl)methyl]-3-oxamoylindol-4-yl]oxyacetic acid (PubChem CID 142170559) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is 2-[2-ethyl-1-[(3-methyl-2-phenylcyclohexyl)methyl]-3-oxamoylindol-4-yl]oxyacetic acid.
| Compound Name | 2-[2-ethyl-1-[(3-methyl-2-phenylcyclohexyl)methyl]-3-oxamoylindol-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 142170559 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 2-[2-ethyl-1-[(3-methyl-2-phenylcyclohexyl)methyl]-3-oxamoylindol-4-yl]oxyacetic acid |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)O)cccc2n1CC1CCCC(C)C1c1ccccc1 |
| InChI | InChI=1S/C28H32N2O5/c1-3-20-26(27(33)28(29)34)25-21(13-8-14-22(25)35-16-23(31)32)30(20)15-19-12-7-9-17(2)24(19)18-10-5-4-6-11-18/h4-6,8,10-11,13-14,17,19,24H,3,7,9,12,15-16H2,1-2H3,(H2,29,34)(H,31,32) |
| InChIKey | SVZYHWJANODNHL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|