C24H26N2O5 — CID 10835989
methyl 2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxy-2-methylpropanoate (PubChem CID 10835989) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is methyl 2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxy-2-methylpropanoate.
| Compound Name | methyl 2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 10835989 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | methyl 2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxy-2-methylpropanoate |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OC(C)(C)C(=O)OC)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C24H26N2O5/c1-5-16-20(21(27)22(25)28)19-17(26(16)14-15-10-7-6-8-11-15)12-9-13-18(19)31-24(2,3)23(29)30-4/h6-13H,5,14H2,1-4H3,(H2,25,28) |
| InChIKey | UYYXKQJELOWVBK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|