C20H17F2N3O4 — CID 16657120
2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide (PubChem CID 16657120) has the molecular formula C20H17F2N3O4 and a molecular weight of 401.37 g/mol. Its IUPAC name is 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide.
| Compound Name | 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 16657120 |
| Molecular Formula | C20H17F2N3O4 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OC(F)(F)C(N)=O)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C20H17F2N3O4/c1-11-15(17(26)18(23)27)16-13(25(11)10-12-6-3-2-4-7-12)8-5-9-14(16)29-20(21,22)19(24)28/h2-9H,10H2,1H3,(H2,23,27)(H2,24,28) |
| InChIKey | LWBLNELQIIEPBE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|