About 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide
2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide (PubChem CID 16657120) has the molecular formula C20H17F2N3O4
and a molecular weight of 401.37 g/mol. Its IUPAC name is 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide |
| PubChem CID | 16657120 |
| Molecular Formula | C20H17F2N3O4 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OC(F)(F)C(N)=O)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C20H17F2N3O4/c1-11-15(17(26)18(23)27)16-13(25(11)10-12-6-3-2-4-7-12)8-5-9-14(16)29-20(21,22)19(24)28/h2-9H,10H2,1H3,(H2,23,27)(H2,24,28) |
| InChIKey | LWBLNELQIIEPBE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide?
The IUPAC name of 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide (CID 16657120) is 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide.
What is the SMILES notation for 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide?
The canonical SMILES for 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide is Cc1c(C(=O)C(N)=O)c2c(OC(F)(F)C(N)=O)cccc2n1Cc1ccccc1.
What is the InChIKey of 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide?
The InChIKey is LWBLNELQIIEPBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F2N3O4/c1-11-15(17(26)18(23)27)16-13(25(11)10-12-6-3-2-4-7-12)8-5-9-14(16)29-20(21,22)19(24)28/h2-9H,10H2,1H3,(H2,23,27)(H2,24,28).
What are the key properties of 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide?
2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide has a molecular weight of 401.37 g/mol, XLogP of 2.12, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,2-difluoroacetamide is sourced from PubChem (CID 16657120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).