C26H21N2NaO5 — CID 23689971
sodium 2-[2-methyl-3-oxamoyl-1-[(3-phenylphenyl)methyl]indol-4-yl]oxyacetate (PubChem CID 23689971) has the molecular formula C26H21N2NaO5 and a molecular weight of 464.45 g/mol. Its IUPAC name is sodium 2-[2-methyl-3-oxamoyl-1-[(3-phenylphenyl)methyl]indol-4-yl]oxyacetate.
| Compound Name | sodium 2-[2-methyl-3-oxamoyl-1-[(3-phenylphenyl)methyl]indol-4-yl]oxyacetate |
|---|---|
| PubChem CID | 23689971 |
| Molecular Formula | C26H21N2NaO5 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | sodium 2-[2-methyl-3-oxamoyl-1-[(3-phenylphenyl)methyl]indol-4-yl]oxyacetate |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OCC(=O)[O-])cccc2n1Cc1cccc(-c2ccccc2)c1.[Na+] |
| InChI | InChI=1S/C26H22N2O5.Na/c1-16-23(25(31)26(27)32)24-20(11-6-12-21(24)33-15-22(29)30)28(16)14-17-7-5-10-19(13-17)18-8-3-2-4-9-18;/h2-13H,14-15H2,1H3,(H2,27,32)(H,29,30);/q;+1/p-1 |
| InChIKey | NBVYQZUQVQVZIT-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|