C35H30N2O7 — CID 59170305
dibenzyl 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxypropanedioate (PubChem CID 59170305) has the molecular formula C35H30N2O7 and a molecular weight of 590.63 g/mol. Its IUPAC name is dibenzyl 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxypropanedioate.
| Compound Name | dibenzyl 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxypropanedioate |
|---|---|
| PubChem CID | 59170305 |
| Molecular Formula | C35H30N2O7 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | dibenzyl 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxypropanedioate |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OC(C(=O)OCc3ccccc3)C(=O)OCc3ccccc3)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C35H30N2O7/c1-23-29(31(38)33(36)39)30-27(37(23)20-24-12-5-2-6-13-24)18-11-19-28(30)44-32(34(40)42-21-25-14-7-3-8-15-25)35(41)43-22-26-16-9-4-10-17-26/h2-19,32H,20-22H2,1H3,(H2,36,39) |
| InChIKey | NHLMMOXHCWBFPU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|