C22H21FN2O5 — CID 59170400
ethyl 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2-fluoroacetate (PubChem CID 59170400) has the molecular formula C22H21FN2O5 and a molecular weight of 412.42 g/mol. Its IUPAC name is ethyl 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2-fluoroacetate.
| Compound Name | ethyl 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2-fluoroacetate |
|---|---|
| PubChem CID | 59170400 |
| Molecular Formula | C22H21FN2O5 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | ethyl 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)Oc1cccc2c1c(C(=O)C(N)=O)c(C)n2Cc1ccccc1 |
| InChI | InChI=1S/C22H21FN2O5/c1-3-29-22(28)20(23)30-16-11-7-10-15-18(16)17(19(26)21(24)27)13(2)25(15)12-14-8-5-4-6-9-14/h4-11,20H,3,12H2,1-2H3,(H2,24,27) |
| InChIKey | POGZAHDVSNUCQM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|