C26H29N3O6 — CID 25099984
1-morpholin-4-ylethyl 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxyacetate (PubChem CID 25099984) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is 1-morpholin-4-ylethyl 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxyacetate.
| Compound Name | 1-morpholin-4-ylethyl 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxyacetate |
|---|---|
| PubChem CID | 25099984 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 1-morpholin-4-ylethyl 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxyacetate |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OCC(=O)OC(C)N3CCOCC3)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C26H29N3O6/c1-17-23(25(31)26(27)32)24-20(29(17)15-19-7-4-3-5-8-19)9-6-10-21(24)34-16-22(30)35-18(2)28-11-13-33-14-12-28/h3-10,18H,11-16H2,1-2H3,(H2,27,32) |
| InChIKey | UYEBHBKJSQBYDD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|